C21H20N4OS2 — CID 1079802
2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-1-phenylethanone (PubChem CID 1079802) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-1-phenylethanone.
| Compound Name | 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 1079802 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[(7-ethyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)sulfanyl]-1-phenylethanone |
| SMILES | CCc1nc2sc3c(c2c2nnc(SCC(=O)c4ccccc4)n12)CCCC3 |
| InChI | InChI=1S/C21H20N4OS2/c1-2-17-22-20-18(14-10-6-7-11-16(14)28-20)19-23-24-21(25(17)19)27-12-15(26)13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12H2,1H3 |
| InChIKey | WFGYLLNMYNSPQI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |