C18H22N6O2S2 — CID 7383304
N'-acetyl-2-[[(13S)-7-ethyl-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetohydrazide (PubChem CID 7383304) has the molecular formula C18H22N6O2S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is N'-acetyl-2-[[(13S)-7-ethyl-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[[(13S)-7-ethyl-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 7383304 |
| Molecular Formula | C18H22N6O2S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N'-acetyl-2-[[(13S)-7-ethyl-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetohydrazide |
| SMILES | CCc1nc2sc3c(c2c2nnc(SCC(=O)NNC(C)=O)n12)CC[C@H](C)C3 |
| InChI | InChI=1S/C18H22N6O2S2/c1-4-13-19-17-15(11-6-5-9(2)7-12(11)28-17)16-22-23-18(24(13)16)27-8-14(26)21-20-10(3)25/h9H,4-8H2,1-3H3,(H,20,25)(H,21,26)/t9-/m0/s1 |
| InChIKey | UAHVNAGQALUSEA-VIFPVBQESA-N |
| XLogP | 2.29 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|