C20H19N5OS2 — CID 3844323
N-benzyl-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide (PubChem CID 3844323) has the molecular formula C20H19N5OS2 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-benzyl-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide.
| Compound Name | N-benzyl-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3844323 |
| Molecular Formula | C20H19N5OS2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-benzyl-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c3c4c(sc3ncn12)CCCC4)NCc1ccccc1 |
| InChI | InChI=1S/C20H19N5OS2/c26-16(21-10-13-6-2-1-3-7-13)11-27-20-24-23-18-17-14-8-4-5-9-15(14)28-19(17)22-12-25(18)20/h1-3,6-7,12H,4-5,8-11H2,(H,21,26) |
| InChIKey | QSDOGZDCVSRXOS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |