C11H10N4S — CID 2841058
5-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene (PubChem CID 2841058) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 5-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene.
| Compound Name | 5-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
|---|---|
| PubChem CID | 2841058 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
| SMILES | Cc1nnc2c3c4c(sc3ncn12)CCC4 |
| InChI | InChI=1S/C11H10N4S/c1-6-13-14-10-9-7-3-2-4-8(7)16-11(9)12-5-15(6)10/h5H,2-4H2,1H3 |
| InChIKey | FBMHMLOLGKNBDV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |