C15H11N5S — CID 946996
4-pyridin-4-yl-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene (PubChem CID 946996) has the molecular formula C15H11N5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-pyridin-4-yl-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene.
| Compound Name | 4-pyridin-4-yl-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
|---|---|
| PubChem CID | 946996 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-pyridin-4-yl-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
| SMILES | c1cc(-c2nc3c4c5c(sc4ncn3n2)CCC5)ccn1 |
| InChI | InChI=1S/C15H11N5S/c1-2-10-11(3-1)21-15-12(10)14-18-13(19-20(14)8-17-15)9-4-6-16-7-5-9/h4-8H,1-3H2 |
| InChIKey | LZGKKBJRGDONCD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |