C20H15N5OS — CID 4909025
4-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)-1H-quinolin-2-one (PubChem CID 4909025) has the molecular formula C20H15N5OS and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)-1H-quinolin-2-one.
| Compound Name | 4-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 4909025 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)-1H-quinolin-2-one |
| SMILES | O=c1cc(-c2nc3c4c5c(sc4ncn3n2)CCCC5)c2ccccc2[nH]1 |
| InChI | InChI=1S/C20H15N5OS/c26-16-9-13(11-5-1-3-7-14(11)22-16)18-23-19-17-12-6-2-4-8-15(12)27-20(17)21-10-25(19)24-18/h1,3,5,7,9-10H,2,4,6,8H2,(H,22,26) |
| InChIKey | ANDJIPWOWHSHKU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |