C19H16N4S — CID 51390759
4-[(1S,2R)-2-phenylcyclopropyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene (PubChem CID 51390759) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-[(1S,2R)-2-phenylcyclopropyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene.
| Compound Name | 4-[(1S,2R)-2-phenylcyclopropyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
|---|---|
| PubChem CID | 51390759 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[(1S,2R)-2-phenylcyclopropyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
| SMILES | c1ccc([C@@H]2C[C@@H]2c2nc3c4c5c(sc4ncn3n2)CCC5)cc1 |
| InChI | InChI=1S/C19H16N4S/c1-2-5-11(6-3-1)13-9-14(13)17-21-18-16-12-7-4-8-15(12)24-19(16)20-10-23(18)22-17/h1-3,5-6,10,13-14H,4,7-9H2/t13-,14-/m0/s1 |
| InChIKey | XOPZBOGDGAAQJL-KBPBESRZSA-N |
| XLogP | 4.10 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |