C17H12Cl2N4OS — CID 4773523
4-[(3,4-dichlorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene (PubChem CID 4773523) has the molecular formula C17H12Cl2N4OS and a molecular weight of 391.28 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene.
| Compound Name | 4-[(3,4-dichlorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
|---|---|
| PubChem CID | 4773523 |
| Molecular Formula | C17H12Cl2N4OS |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 4-[(3,4-dichlorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
| SMILES | Clc1ccc(OCc2nc3c4c5c(sc4ncn3n2)CCC5)cc1Cl |
| InChI | InChI=1S/C17H12Cl2N4OS/c18-11-5-4-9(6-12(11)19)24-7-14-21-16-15-10-2-1-3-13(10)25-17(15)20-8-23(16)22-14/h4-6,8H,1-3,7H2 |
| InChIKey | KXCOZVRSXFRDJA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |