C20H18ClN5OS — CID 6222024
(Z)-1-(4-chlorophenyl)-N-(9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaen-15-ylmethoxy)methanimine (PubChem CID 6222024) has the molecular formula C20H18ClN5OS and a molecular weight of 411.92 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-(9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaen-15-ylmethoxy)methanimine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-(9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaen-15-ylmethoxy)methanimine |
|---|---|
| PubChem CID | 6222024 |
| Molecular Formula | C20H18ClN5OS |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-(9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaen-15-ylmethoxy)methanimine |
| SMILES | Clc1ccc(/C=N\OCc2nc3c4c5c(sc4ncn3n2)CCCCC5)cc1 |
| InChI | InChI=1S/C20H18ClN5OS/c21-14-8-6-13(7-9-14)10-23-27-11-17-24-19-18-15-4-2-1-3-5-16(15)28-20(18)22-12-26(19)25-17/h6-10,12H,1-5,11H2/b23-10- |
| InChIKey | PPUSMWCWDWHXHP-RMORIDSASA-N |
| XLogP | 4.81 |
| TPSA | 64.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|