C20H20N4OS — CID 1149370
15-[(4-methylphenoxy)methyl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene (PubChem CID 1149370) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 15-[(4-methylphenoxy)methyl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene.
| Compound Name | 15-[(4-methylphenoxy)methyl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
|---|---|
| PubChem CID | 1149370 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 15-[(4-methylphenoxy)methyl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
| SMILES | Cc1ccc(OCc2nc3c4c5c(sc4ncn3n2)CCCCC5)cc1 |
| InChI | InChI=1S/C20H20N4OS/c1-13-7-9-14(10-8-13)25-11-17-22-19-18-15-5-3-2-4-6-16(15)26-20(18)21-12-24(19)23-17/h7-10,12H,2-6,11H2,1H3 |
| InChIKey | BNWKGUQTXOSWFR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |