C20H19FN4OS — CID 19571564
13-ethyl-4-[(4-fluorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 19571564) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 13-ethyl-4-[(4-fluorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 13-ethyl-4-[(4-fluorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 19571564 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 13-ethyl-4-[(4-fluorophenoxy)methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CCC1CCc2c(sc3ncn4nc(COc5ccc(F)cc5)nc4c23)C1 |
| InChI | InChI=1S/C20H19FN4OS/c1-2-12-3-8-15-16(9-12)27-20-18(15)19-23-17(24-25(19)11-22-20)10-26-14-6-4-13(21)5-7-14/h4-7,11-12H,2-3,8-10H2,1H3 |
| InChIKey | NROFYRFXHBRMBS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |