C26H26N4OS — CID 40906600
(13S)-13-tert-butyl-4-(naphthalen-1-yloxymethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 40906600) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is (13S)-13-tert-butyl-4-(naphthalen-1-yloxymethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | (13S)-13-tert-butyl-4-(naphthalen-1-yloxymethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 40906600 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (13S)-13-tert-butyl-4-(naphthalen-1-yloxymethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc3ncn4nc(COc5cccc6ccccc56)nc4c23)C1 |
| InChI | InChI=1S/C26H26N4OS/c1-26(2,3)17-11-12-19-21(13-17)32-25-23(19)24-28-22(29-30(24)15-27-25)14-31-20-10-6-8-16-7-4-5-9-18(16)20/h4-10,15,17H,11-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | QHNLVOFNAKBYJD-KRWDZBQOSA-N |
| XLogP | 6.22 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |