C23H24N8S — CID 19573541
13-tert-butyl-4-[[4-(tetrazol-1-yl)phenyl]methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 19573541) has the molecular formula C23H24N8S and a molecular weight of 444.57 g/mol. Its IUPAC name is 13-tert-butyl-4-[[4-(tetrazol-1-yl)phenyl]methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 13-tert-butyl-4-[[4-(tetrazol-1-yl)phenyl]methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 19573541 |
| Molecular Formula | C23H24N8S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 13-tert-butyl-4-[[4-(tetrazol-1-yl)phenyl]methyl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CC(C)(C)C1CCc2c(sc3ncn4nc(Cc5ccc(-n6cnnn6)cc5)nc4c23)C1 |
| InChI | InChI=1S/C23H24N8S/c1-23(2,3)15-6-9-17-18(11-15)32-22-20(17)21-26-19(27-31(21)12-24-22)10-14-4-7-16(8-5-14)30-13-25-28-29-30/h4-5,7-8,12-13,15H,6,9-11H2,1-3H3 |
| InChIKey | WIYBPTGXXGBGAC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |