C19H18N4OS — CID 136737011
2-[(13R)-13-ethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl]phenol (PubChem CID 136737011) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-[(13R)-13-ethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl]phenol.
| Compound Name | 2-[(13R)-13-ethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl]phenol |
|---|---|
| PubChem CID | 136737011 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[(13R)-13-ethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl]phenol |
| SMILES | CC[C@@H]1CCc2c(sc3ncn4nc(-c5ccccc5O)nc4c23)C1 |
| InChI | InChI=1S/C19H18N4OS/c1-2-11-7-8-13-15(9-11)25-19-16(13)18-21-17(22-23(18)10-20-19)12-5-3-4-6-14(12)24/h3-6,10-11,24H,2,7-9H2,1H3/t11-/m1/s1 |
| InChIKey | STKFLJDBPDKSMD-LLVKDONJSA-N |
| XLogP | 4.23 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |