C15H12N4S2 — CID 5306537
4-(thiophen-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene (PubChem CID 5306537) has the molecular formula C15H12N4S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene.
| Compound Name | 4-(thiophen-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
|---|---|
| PubChem CID | 5306537 |
| Molecular Formula | C15H12N4S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-(thiophen-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaene |
| SMILES | c1csc(Cc2nc3c4c5c(sc4ncn3n2)CCC5)c1 |
| InChI | InChI=1S/C15H12N4S2/c1-4-10-11(5-1)21-15-13(10)14-17-12(18-19(14)8-16-15)7-9-3-2-6-20-9/h2-3,6,8H,1,4-5,7H2 |
| InChIKey | XAWLKDWLWXWABN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |