C20H18ClN5OS — CID 4898360
1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine (PubChem CID 4898360) has the molecular formula C20H18ClN5OS and a molecular weight of 411.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 4898360 |
| Molecular Formula | C20H18ClN5OS |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine |
| SMILES | CC1CCc2c(sc3ncn4nc(CON=Cc5ccc(Cl)cc5)nc4c23)C1 |
| InChI | InChI=1S/C20H18ClN5OS/c1-12-2-7-15-16(8-12)28-20-18(15)19-24-17(25-26(19)11-22-20)10-27-23-9-13-3-5-14(21)6-4-13/h3-6,9,11-12H,2,7-8,10H2,1H3 |
| InChIKey | GYIULSYKBKNCKL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|