C19H17ClN6OS — CID 6389669
(Z)-1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine (PubChem CID 6389669) has the molecular formula C19H17ClN6OS and a molecular weight of 412.91 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 6389669 |
| Molecular Formula | C19H17ClN6OS |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]methanimine |
| SMILES | CN1CCc2c(sc3ncn4nc(CO/N=C\c5ccc(Cl)cc5)nc4c23)C1 |
| InChI | InChI=1S/C19H17ClN6OS/c1-25-7-6-14-15(9-25)28-19-17(14)18-23-16(24-26(18)11-21-19)10-27-22-8-12-2-4-13(20)5-3-12/h2-5,8,11H,6-7,9-10H2,1H3/b22-8- |
| InChIKey | ZUPBYFOESFUYFR-UYOCIXKTSA-N |
| XLogP | 3.53 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|