C18H18N6OS2 — CID 3696922
N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine (PubChem CID 3696922) has the molecular formula C18H18N6OS2 and a molecular weight of 398.52 g/mol. Its IUPAC name is N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine.
| Compound Name | N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine |
|---|---|
| PubChem CID | 3696922 |
| Molecular Formula | C18H18N6OS2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[(13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine |
| SMILES | CC(=NOCc1nc2c3c4c(sc3ncn2n1)CN(C)CC4)c1cccs1 |
| InChI | InChI=1S/C18H18N6OS2/c1-11(13-4-3-7-26-13)22-25-9-15-20-17-16-12-5-6-23(2)8-14(12)27-18(16)19-10-24(17)21-15/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | BTDHDNHRLWSKQH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|