C18H19N6OS2+ — CID 7377718
(E)-N-[(13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine (PubChem CID 7377718) has the molecular formula C18H19N6OS2+ and a molecular weight of 399.53 g/mol. Its IUPAC name is (E)-N-[(13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine.
| Compound Name | (E)-N-[(13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine |
|---|---|
| PubChem CID | 7377718 |
| Molecular Formula | C18H19N6OS2+ |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-N-[(13-methyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)methoxy]-1-thiophen-2-ylethanimine |
| SMILES | C/C(=N\OCc1nc2c3c4c(sc3ncn2n1)C[NH+](C)CC4)c1cccs1 |
| InChI | InChI=1S/C18H18N6OS2/c1-11(13-4-3-7-26-13)22-25-9-15-20-17-16-12-5-6-23(2)8-14(12)27-18(16)19-10-24(17)21-15/h3-4,7,10H,5-6,8-9H2,1-2H3/p+1/b22-11+ |
| InChIKey | BTDHDNHRLWSKQH-SSDVNMTOSA-O |
| XLogP | 1.91 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|