C22H19N7O — CID 6385549
(Z)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-phenylethanimine (PubChem CID 6385549) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is (Z)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-phenylethanimine.
| Compound Name | (Z)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-phenylethanimine |
|---|---|
| PubChem CID | 6385549 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (Z)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-phenylethanimine |
| SMILES | C/C(=N/OCc1nc2c3cnn(Cc4ccccc4)c3ncn2n1)c1ccccc1 |
| InChI | InChI=1S/C22H19N7O/c1-16(18-10-6-3-7-11-18)27-30-14-20-25-22-19-12-24-28(13-17-8-4-2-5-9-17)21(19)23-15-29(22)26-20/h2-12,15H,13-14H2,1H3/b27-16- |
| InChIKey | SSJJMRZHOZDWEU-YUMHPJSZSA-N |
| XLogP | 3.46 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|