C11H11N5S — CID 915957
9-thia-11,13,14,15,16-pentazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene (PubChem CID 915957) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 9-thia-11,13,14,15,16-pentazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene.
| Compound Name | 9-thia-11,13,14,15,16-pentazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
|---|---|
| PubChem CID | 915957 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 9-thia-11,13,14,15,16-pentazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
| SMILES | c1nc2sc3c(c2c2nnnn12)CCCCC3 |
| InChI | InChI=1S/C11H11N5S/c1-2-4-7-8(5-3-1)17-11-9(7)10-13-14-15-16(10)6-12-11/h6H,1-5H2 |
| InChIKey | DZIUSIMNPXGGQK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |