C20H21N5S — CID 4970409
N,N-dimethyl-4-(15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)aniline (PubChem CID 4970409) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is N,N-dimethyl-4-(15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)aniline.
| Compound Name | N,N-dimethyl-4-(15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)aniline |
|---|---|
| PubChem CID | 4970409 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N,N-dimethyl-4-(15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)aniline |
| SMILES | CC1CCCc2sc3ncn4nc(-c5ccc(N(C)C)cc5)nc4c3c21 |
| InChI | InChI=1S/C20H21N5S/c1-12-5-4-6-15-16(12)17-19-22-18(23-25(19)11-21-20(17)26-15)13-7-9-14(10-8-13)24(2)3/h7-12H,4-6H2,1-3H3 |
| InChIKey | XUVXGTWCLSJDST-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |