C18H17N5O2S — CID 4885873
N-(furan-2-ylmethyl)-15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide (PubChem CID 4885873) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 4885873 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-15-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide |
| SMILES | CC1CCCc2sc3ncn4nc(C(=O)NCc5ccco5)nc4c3c21 |
| InChI | InChI=1S/C18H17N5O2S/c1-10-4-2-6-12-13(10)14-16-21-15(22-23(16)9-20-18(14)26-12)17(24)19-8-11-5-3-7-25-11/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,19,24) |
| InChIKey | POSYBNLIOKWULV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |