C19H25N5O2S — CID 4886581
N-(3-ethoxypropyl)-7,15-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide (PubChem CID 4886581) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-7,15-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-7,15-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 4886581 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-(3-ethoxypropyl)-7,15-dimethyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1nc2c3c4c(sc3nc(C)n2n1)CCCC4C |
| InChI | InChI=1S/C19H25N5O2S/c1-4-26-10-6-9-20-18(25)16-22-17-15-14-11(2)7-5-8-13(14)27-19(15)21-12(3)24(17)23-16/h11H,4-10H2,1-3H3,(H,20,25) |
| InChIKey | WCYQATXHDSNMPA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|