C20H29N6OS+ — CID 2030618
diethyl-[3-[(7-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carbonyl)amino]propyl]azanium (PubChem CID 2030618) has the molecular formula C20H29N6OS+ and a molecular weight of 401.56 g/mol. Its IUPAC name is diethyl-[3-[(7-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carbonyl)amino]propyl]azanium.
| Compound Name | diethyl-[3-[(7-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carbonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 2030618 |
| Molecular Formula | C20H29N6OS+ |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | diethyl-[3-[(7-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene-4-carbonyl)amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)c1nc2c3c4c(sc3nc(C)n2n1)CCCC4 |
| InChI | InChI=1S/C20H28N6OS/c1-4-25(5-2)12-8-11-21-19(27)17-23-18-16-14-9-6-7-10-15(14)28-20(16)22-13(3)26(18)24-17/h4-12H2,1-3H3,(H,21,27)/p+1 |
| InChIKey | DXRGODYUUBKAKO-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|