C16H12N4O2S2 — CID 9333839
2-(furan-2-yl)-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,3,4-oxadiazole (PubChem CID 9333839) has the molecular formula C16H12N4O2S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9333839 |
| Molecular Formula | C16H12N4O2S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(furan-2-yl)-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,3,4-oxadiazole |
| SMILES | c1coc(-c2nnc(Sc3ncnc4sc5c(c34)CCCC5)o2)c1 |
| InChI | InChI=1S/C16H12N4O2S2/c1-2-6-11-9(4-1)12-14(23-11)17-8-18-15(12)24-16-20-19-13(22-16)10-5-3-7-21-10/h3,5,7-8H,1-2,4,6H2 |
| InChIKey | MRSLNVRCEWJBSU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |