C13H14N6S2 — CID 47015646
3-methyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 47015646) has the molecular formula C13H14N6S2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 3-methyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-methyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 47015646 |
| Molecular Formula | C13H14N6S2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-methyl-5-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)-1,2,4-triazol-4-amine |
| SMILES | Cc1nnc(Sc2ncnc3sc4c(c23)CCCC4)n1N |
| InChI | InChI=1S/C13H14N6S2/c1-7-17-18-13(19(7)14)21-12-10-8-4-2-3-5-9(8)20-11(10)15-6-16-12/h6H,2-5,14H2,1H3 |
| InChIKey | VCGUCOSFPLIVJB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |