C18H16N6S2 — CID 9340316
12-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene (PubChem CID 9340316) has the molecular formula C18H16N6S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 12-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene.
| Compound Name | 12-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene |
|---|---|
| PubChem CID | 9340316 |
| Molecular Formula | C18H16N6S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 12-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene |
| SMILES | Cc1ccc(-n2nnnc2Sc2ncnc3sc4c(c23)CCC4)cc1C |
| InChI | InChI=1S/C18H16N6S2/c1-10-6-7-12(8-11(10)2)24-18(21-22-23-24)26-17-15-13-4-3-5-14(13)25-16(15)19-9-20-17/h6-9H,3-5H2,1-2H3 |
| InChIKey | UMCBIDWFCXNAKZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |