C15H18N2OS2 — CID 4811977
3,3-dimethyl-1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butan-2-one (PubChem CID 4811977) has the molecular formula C15H18N2OS2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 3,3-dimethyl-1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butan-2-one |
|---|---|
| PubChem CID | 4811977 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3,3-dimethyl-1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butan-2-one |
| SMILES | CC(C)(C)C(=O)CSc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C15H18N2OS2/c1-15(2,3)11(18)7-19-13-12-9-5-4-6-10(9)20-14(12)17-8-16-13/h8H,4-7H2,1-3H3 |
| InChIKey | WWEQYTGVJNSWDR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |