C15H15N5OS3 — CID 3184581
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 3184581) has the molecular formula C15H15N5OS3 and a molecular weight of 377.52 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3184581 |
| Molecular Formula | C15H15N5OS3 |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2ncnc3sc4c(c23)CCC4)s1 |
| InChI | InChI=1S/C15H15N5OS3/c1-2-11-19-20-15(24-11)18-10(21)6-22-13-12-8-4-3-5-9(8)23-14(12)17-7-16-13/h7H,2-6H2,1H3,(H,18,20,21) |
| InChIKey | NHLFDDWMIRQWMB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |