C23H23N5O2S3 — CID 3206596
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(phenoxymethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide (PubChem CID 3206596) has the molecular formula C23H23N5O2S3 and a molecular weight of 497.67 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(phenoxymethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(phenoxymethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3206596 |
| Molecular Formula | C23H23N5O2S3 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[2-(phenoxymethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2nc(COc3ccccc3)nc3sc4c(c23)CCCC4)s1 |
| InChI | InChI=1S/C23H23N5O2S3/c1-2-19-27-28-23(33-19)26-18(29)13-31-21-20-15-10-6-7-11-16(15)32-22(20)25-17(24-21)12-30-14-8-4-3-5-9-14/h3-5,8-9H,2,6-7,10-13H2,1H3,(H,26,28,29) |
| InChIKey | PKOOAIGWPXYZFS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |