C23H21FN4OS3 — CID 3189372
2-[(2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 3189372) has the molecular formula C23H21FN4OS3 and a molecular weight of 484.65 g/mol. Its IUPAC name is 2-[(2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3189372 |
| Molecular Formula | C23H21FN4OS3 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 2-[(2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCc1nc(SCC(=O)Nc2nc(-c3ccc(F)cc3)cs2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C23H21FN4OS3/c1-2-18-26-21(20-15-5-3-4-6-17(15)32-22(20)27-18)30-12-19(29)28-23-25-16(11-31-23)13-7-9-14(24)10-8-13/h7-11H,2-6,12H2,1H3,(H,25,28,29) |
| InChIKey | TYEBPBXIZGFPMN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |