C22H20N4O2S3 — CID 26012226
N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide (PubChem CID 26012226) has the molecular formula C22H20N4O2S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide.
| Compound Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 26012226 |
| Molecular Formula | C22H20N4O2S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSCc3nc4sc5c(c4c(=O)[nH]3)CCC5)n2)cc1 |
| InChI | InChI=1S/C22H20N4O2S3/c1-12-5-7-13(8-6-12)15-9-30-22(23-15)26-18(27)11-29-10-17-24-20(28)19-14-3-2-4-16(14)31-21(19)25-17/h5-9H,2-4,10-11H2,1H3,(H,23,26,27)(H,24,25,28) |
| InChIKey | VPLFSJFDJRSESY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |