C17H19N5O2S3 — CID 26881303
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide (PubChem CID 26881303) has the molecular formula C17H19N5O2S3 and a molecular weight of 421.57 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 26881303 |
| Molecular Formula | C17H19N5O2S3 |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
| SMILES | CCc1nnc(NC(=O)CSCc2nc3sc4c(c3c(=O)[nH]2)CCCC4)s1 |
| InChI | InChI=1S/C17H19N5O2S3/c1-2-13-21-22-17(27-13)20-12(23)8-25-7-11-18-15(24)14-9-5-3-4-6-10(9)26-16(14)19-11/h2-8H2,1H3,(H,18,19,24)(H,20,22,23) |
| InChIKey | VXMWCYBRFJTWRF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |