C19H21N5O2S3 — CID 55331971
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide (PubChem CID 55331971) has the molecular formula C19H21N5O2S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 55331971 |
| Molecular Formula | C19H21N5O2S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide |
| SMILES | O=C(CCSCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C19H21N5O2S3/c25-14(22-19-24-23-17(29-19)10-5-6-10)7-8-27-9-13-20-16(26)15-11-3-1-2-4-12(11)28-18(15)21-13/h10H,1-9H2,(H,20,21,26)(H,22,24,25) |
| InChIKey | MAMYHXINYMVAFE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|