C24H27N3O2S2 — CID 55339772
3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide (PubChem CID 55339772) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide.
| Compound Name | 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 55339772 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
| SMILES | O=C(CCSCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H27N3O2S2/c28-21(25-17-10-9-15-5-1-2-6-16(15)13-17)11-12-30-14-20-26-23(29)22-18-7-3-4-8-19(18)31-24(22)27-20/h1-2,5-6,17H,3-4,7-14H2,(H,25,28)(H,26,27,29) |
| InChIKey | BXSBPXTXJFCNPL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|