C22H23N3O2S2 — CID 55340040
2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 55340040) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 55340040 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | O=C(CSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H23N3O2S2/c26-19(23-15-9-8-13-4-1-2-5-14(13)10-15)12-28-11-18-24-21(27)20-16-6-3-7-17(16)29-22(20)25-18/h1-2,4-5,15H,3,6-12H2,(H,23,26)(H,24,25,27) |
| InChIKey | VKPZLBNTQAJSRH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |