C20H27N3O2S2 — CID 8928995
N-[(1S,2R)-2-methylcyclohexyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide (PubChem CID 8928995) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 8928995 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)CSCc1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C20H27N3O2S2/c1-12-6-2-4-8-14(12)21-17(24)11-26-10-16-22-19(25)18-13-7-3-5-9-15(13)27-20(18)23-16/h12,14H,2-11H2,1H3,(H,21,24)(H,22,23,25)/t12-,14+/m1/s1 |
| InChIKey | KAZJYSNBILCLAH-OCCSQVGLSA-N |
| XLogP | 3.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |