C22H29N3O4S — CID 2099181
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate (PubChem CID 2099181) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
|---|---|
| PubChem CID | 2099181 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C22H29N3O4S/c1-13-6-2-4-8-15(13)23-18(26)12-29-19(27)11-10-17-24-21(28)20-14-7-3-5-9-16(14)30-22(20)25-17/h13,15H,2-12H2,1H3,(H,23,26)(H,24,25,28)/t13-,15-/m1/s1 |
| InChIKey | FXOFIIOKKPGABR-UKRRQHHQSA-N |
| XLogP | 3.03 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |