C21H18Cl2N2O4S — CID 42966171
[2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate (PubChem CID 42966171) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
|---|---|
| PubChem CID | 42966171 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)OCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O4S/c22-11-5-6-12(14(23)9-11)15(26)10-29-18(27)8-7-17-24-20(28)19-13-3-1-2-4-16(13)30-21(19)25-17/h5-6,9H,1-4,7-8,10H2,(H,24,25,28) |
| InChIKey | RZTNYJLDDTVFME-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |