C22H19ClN4O4S — CID 46814353
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate (PubChem CID 46814353) has the molecular formula C22H19ClN4O4S and a molecular weight of 470.94 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
|---|---|
| PubChem CID | 46814353 |
| Molecular Formula | C22H19ClN4O4S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C22H19ClN4O4S/c23-13-7-5-12(6-8-13)20-26-17(31-27-20)11-30-18(28)10-9-16-24-21(29)19-14-3-1-2-4-15(14)32-22(19)25-16/h5-8H,1-4,9-11H2,(H,24,25,29) |
| InChIKey | QUSOTKOYHRTYRE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |