C18H15ClN2O3 — CID 134031490
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 3-(4-chlorophenyl)propanoate (PubChem CID 134031490) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 3-(4-chlorophenyl)propanoate.
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 134031490 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 3-(4-chlorophenyl)propanoate |
| SMILES | O=C(CCc1ccc(Cl)cc1)OCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-15-9-6-13(7-10-15)8-11-17(22)23-12-16-20-18(21-24-16)14-4-2-1-3-5-14/h1-7,9-10H,8,11-12H2 |
| InChIKey | FIDTUKHPWBOPRC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |