C19H17ClN2O3 — CID 8522651
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (3S)-3-phenylbutanoate (PubChem CID 8522651) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (3S)-3-phenylbutanoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 8522651 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCc1nc(-c2ccc(Cl)cc2)no1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-13(14-5-3-2-4-6-14)11-18(23)24-12-17-21-19(22-25-17)15-7-9-16(20)10-8-15/h2-10,13H,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | NVHMTKRGNWPCCN-ZDUSSCGKSA-N |
| XLogP | 4.63 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |