C16H14ClN3O — CID 43102262
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine (PubChem CID 43102262) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine.
| Compound Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine |
|---|---|
| PubChem CID | 43102262 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanamine |
| SMILES | NC(Cc1nc(-c2ccc(Cl)cc2)no1)c1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O/c17-13-8-6-12(7-9-13)16-19-15(21-20-16)10-14(18)11-4-2-1-3-5-11/h1-9,14H,10,18H2 |
| InChIKey | BIXMJSZZOSNAGV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |