C19H27N3O2S2 — CID 11892289
N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide (PubChem CID 11892289) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 11892289 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetamide |
| SMILES | Cc1sc2nc(CSCC(=O)N[C@@H]3CCC[C@H](C)[C@@H]3C)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H27N3O2S2/c1-10-6-5-7-14(11(10)2)20-16(23)9-25-8-15-21-18(24)17-12(3)13(4)26-19(17)22-15/h10-11,14H,5-9H2,1-4H3,(H,20,23)(H,21,22,24)/t10-,11-,14+/m0/s1 |
| InChIKey | PLRLFZYGMZUJNQ-COPLHBTASA-N |
| XLogP | 3.78 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |