C26H31N3O2S2 — CID 60575826
3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide (PubChem CID 60575826) has the molecular formula C26H31N3O2S2 and a molecular weight of 481.69 g/mol. Its IUPAC name is 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide.
| Compound Name | 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 60575826 |
| Molecular Formula | C26H31N3O2S2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
| SMILES | CCCN(C(=O)CCSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H31N3O2S2/c1-2-13-29(19-11-10-17-6-3-4-7-18(17)15-19)23(30)12-14-32-16-22-27-25(31)24-20-8-5-9-21(20)33-26(24)28-22/h3-4,6-7,19H,2,5,8-16H2,1H3,(H,27,28,31) |
| InChIKey | COQWHJURNIIHLL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|