C19H18Cl2N4O2S2 — CID 55362883
N-(4-amino-3,5-dichlorophenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide (PubChem CID 55362883) has the molecular formula C19H18Cl2N4O2S2 and a molecular weight of 469.42 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 55362883 |
| Molecular Formula | C19H18Cl2N4O2S2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
| SMILES | Nc1c(Cl)cc(NC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N4O2S2/c20-11-6-9(7-12(21)17(11)22)23-15(26)4-5-28-8-14-24-18(27)16-10-2-1-3-13(10)29-19(16)25-14/h6-7H,1-5,8,22H2,(H,23,26)(H,24,25,27) |
| InChIKey | XIDFTPCNMROHHK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|