C20H19F3N4O3S2 — CID 55963046
3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide (PubChem CID 55963046) has the molecular formula C20H19F3N4O3S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide.
| Compound Name | 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 55963046 |
| Molecular Formula | C20H19F3N4O3S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
| SMILES | O=C(CCSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)Nc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C20H19F3N4O3S2/c21-20(22,23)10-30-16-5-4-11(8-24-16)25-15(28)6-7-31-9-14-26-18(29)17-12-2-1-3-13(12)32-19(17)27-14/h4-5,8H,1-3,6-7,9-10H2,(H,25,28)(H,26,27,29) |
| InChIKey | MZHRIFGKUVXAER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|