C21H22ClN3O4S2 — CID 24514320
N-(5-chloro-2,4-dimethoxyphenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide (PubChem CID 24514320) has the molecular formula C21H22ClN3O4S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 24514320 |
| Molecular Formula | C21H22ClN3O4S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanamide |
| SMILES | COc1cc(OC)c(NC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)cc1Cl |
| InChI | InChI=1S/C21H22ClN3O4S2/c1-28-14-9-15(29-2)13(8-12(14)22)23-18(26)6-7-30-10-17-24-20(27)19-11-4-3-5-16(11)31-21(19)25-17/h8-9H,3-7,10H2,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | DFWHNKIEKVINEF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|