C23H26N4O4S2 — CID 55333314
N'-[2-(2,5-dimethylphenoxy)acetyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide (PubChem CID 55333314) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 55333314 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-3-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]propanehydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)CCSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)c1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-13-6-7-14(2)16(10-13)31-11-20(29)27-26-19(28)8-9-32-12-18-24-22(30)21-15-4-3-5-17(15)33-23(21)25-18/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H,26,28)(H,27,29)(H,24,25,30) |
| InChIKey | XFEIVSWUVZHNMN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|